C32H33NO4S — CID 68536298
ethyl 2-[3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propylsulfanyl]phenoxy]propanoate (PubChem CID 68536298) has the molecular formula C32H33NO4S and a molecular weight of 527.69 g/mol. Its IUPAC name is ethyl 2-[3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propylsulfanyl]phenoxy]propanoate.
| Compound Name | ethyl 2-[3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propylsulfanyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 68536298 |
| Molecular Formula | C32H33NO4S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | ethyl 2-[3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propylsulfanyl]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1cccc(SCCCn2cc(C(c3ccccc3)c3ccccc3)ccc2=O)c1 |
| InChI | InChI=1S/C32H33NO4S/c1-3-36-32(35)24(2)37-28-16-10-17-29(22-28)38-21-11-20-33-23-27(18-19-30(33)34)31(25-12-6-4-7-13-25)26-14-8-5-9-15-26/h4-10,12-19,22-24,31H,3,11,20-21H2,1-2H3 |
| InChIKey | PVMJJWPRYWKVDQ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|