C32H33NO4 — CID 59145226
ethyl 2-[3-[4-(5-benzhydryl-2-oxo-1-pyridinyl)butyl]phenoxy]acetate (PubChem CID 59145226) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is ethyl 2-[3-[4-(5-benzhydryl-2-oxo-1-pyridinyl)butyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[4-(5-benzhydryl-2-oxo-1-pyridinyl)butyl]phenoxy]acetate |
|---|---|
| PubChem CID | 59145226 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | ethyl 2-[3-[4-(5-benzhydryl-2-oxo-1-pyridinyl)butyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(CCCCn2cc(C(c3ccccc3)c3ccccc3)ccc2=O)c1 |
| InChI | InChI=1S/C32H33NO4/c1-2-36-31(35)24-37-29-18-11-13-25(22-29)12-9-10-21-33-23-28(19-20-30(33)34)32(26-14-5-3-6-15-26)27-16-7-4-8-17-27/h3-8,11,13-20,22-23,32H,2,9-10,12,21,24H2,1H3 |
| InChIKey | WJJJMXXYXGOPHS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|