C29H27NO4 — CID 87645085
[3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propyl]phenyl] ethaneperoxoate (PubChem CID 87645085) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is [3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propyl]phenyl] ethaneperoxoate.
| Compound Name | [3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propyl]phenyl] ethaneperoxoate |
|---|---|
| PubChem CID | 87645085 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | [3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propyl]phenyl] ethaneperoxoate |
| SMILES | CC(=O)OOc1cccc(CCCn2cc(C(c3ccccc3)c3ccccc3)ccc2=O)c1 |
| InChI | InChI=1S/C29H27NO4/c1-22(31)33-34-27-16-8-10-23(20-27)11-9-19-30-21-26(17-18-28(30)32)29(24-12-4-2-5-13-24)25-14-6-3-7-15-25/h2-8,10,12-18,20-21,29H,9,11,19H2,1H3 |
| InChIKey | KECRXPRRUHAMNK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|