C33H34N2O3 — CID 143692726
6-benzhydryl-2-[4-[3-(2-cyclobutylidene-2-hydroxyethoxy)phenyl]butyl]pyridazin-3-one (PubChem CID 143692726) has the molecular formula C33H34N2O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is 6-benzhydryl-2-[4-[3-(2-cyclobutylidene-2-hydroxyethoxy)phenyl]butyl]pyridazin-3-one.
| Compound Name | 6-benzhydryl-2-[4-[3-(2-cyclobutylidene-2-hydroxyethoxy)phenyl]butyl]pyridazin-3-one |
|---|---|
| PubChem CID | 143692726 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 6-benzhydryl-2-[4-[3-(2-cyclobutylidene-2-hydroxyethoxy)phenyl]butyl]pyridazin-3-one |
| SMILES | O=c1ccc(C(c2ccccc2)c2ccccc2)nn1CCCCc1cccc(OCC(O)=C2CCC2)c1 |
| InChI | InChI=1S/C33H34N2O3/c36-31(26-17-10-18-26)24-38-29-19-9-12-25(23-29)11-7-8-22-35-32(37)21-20-30(34-35)33(27-13-3-1-4-14-27)28-15-5-2-6-16-28/h1-6,9,12-16,19-21,23,33,36H,7-8,10-11,17-18,22,24H2 |
| InChIKey | DIOUZNREYFSWBW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|