C14H11N3O4S — CID 68982273
3-cyano-2-methyl-6-(pyridin-2-ylsulfonylamino)benzoic acid (PubChem CID 68982273) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is 3-cyano-2-methyl-6-(pyridin-2-ylsulfonylamino)benzoic acid.
| Compound Name | 3-cyano-2-methyl-6-(pyridin-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 68982273 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-cyano-2-methyl-6-(pyridin-2-ylsulfonylamino)benzoic acid |
| SMILES | Cc1c(C#N)ccc(NS(=O)(=O)c2ccccn2)c1C(=O)O |
| InChI | InChI=1S/C14H11N3O4S/c1-9-10(8-15)5-6-11(13(9)14(18)19)17-22(20,21)12-4-2-3-7-16-12/h2-7,17H,1H3,(H,18,19) |
| InChIKey | LCLWCVUVDXLESL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |