C10H8F3NO2S2 — CID 68982369
3-[(sulfinoamino)methyl]-4-(trifluoromethyl)-1-benzothiophene (PubChem CID 68982369) has the molecular formula C10H8F3NO2S2 and a molecular weight of 295.31 g/mol. Its IUPAC name is 3-[(sulfinoamino)methyl]-4-(trifluoromethyl)-1-benzothiophene.
| Compound Name | 3-[(sulfinoamino)methyl]-4-(trifluoromethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 68982369 |
| Molecular Formula | C10H8F3NO2S2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 3-[(sulfinoamino)methyl]-4-(trifluoromethyl)-1-benzothiophene |
| SMILES | O=S(O)NCc1csc2cccc(C(F)(F)F)c12 |
| InChI | InChI=1S/C10H8F3NO2S2/c11-10(12,13)7-2-1-3-8-9(7)6(5-17-8)4-14-18(15)16/h1-3,5,14H,4H2,(H,15,16) |
| InChIKey | YLKRLWZWNYTCFH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|