C27H30N6O — CID 68983541
7-[2-[3-methyl-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 68983541) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 7-[2-[3-methyl-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[2-[3-methyl-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 68983541 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 7-[2-[3-methyl-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | Cc1cc(Nc2nccc(-c3ccc4c(c3)CCCC(=O)N4)n2)ccc1N1C[C@@H]2C[C@H]1CN2C |
| InChI | InChI=1S/C27H30N6O/c1-17-12-20(7-9-25(17)33-16-21-14-22(33)15-32(21)2)29-27-28-11-10-24(31-27)19-6-8-23-18(13-19)4-3-5-26(34)30-23/h6-13,21-22H,3-5,14-16H2,1-2H3,(H,30,34)(H,28,29,31)/t21-,22-/m0/s1 |
| InChIKey | CGYAPWIUFQULMZ-VXKWHMMOSA-N |
| XLogP | 4.36 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |