About 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate
2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 68985316) has the molecular formula C20H24BrN3O5
and a molecular weight of 466.33 g/mol. Its IUPAC name is 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate |
| PubChem CID | 68985316 |
| Molecular Formula | C20H24BrN3O5 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(C(=O)Nc2c(C(N)=O)oc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C20H24BrN3O5/c1-11(2)10-28-20(27)24-7-5-12(6-8-24)19(26)23-16-14-9-13(21)3-4-15(14)29-17(16)18(22)25/h3-4,9,11-12H,5-8,10H2,1-2H3,(H2,22,25)(H,23,26) |
| InChIKey | OMBDTECSMFTKLQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate?
The IUPAC name of 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate (CID 68985316) is 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate?
The canonical SMILES for 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate is CC(C)COC(=O)N1CCC(C(=O)Nc2c(C(N)=O)oc3ccc(Br)cc23)CC1.
What is the InChIKey of 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate?
The InChIKey is OMBDTECSMFTKLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24BrN3O5/c1-11(2)10-28-20(27)24-7-5-12(6-8-24)19(26)23-16-14-9-13(21)3-4-15(14)29-17(16)18(22)25/h3-4,9,11-12H,5-8,10H2,1-2H3,(H2,22,25)(H,23,26).
What are the key properties of 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate?
2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate has a molecular weight of 466.33 g/mol, XLogP of 3.74, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-[(5-bromo-2-carbamoyl-1-benzofuran-3-yl)carbamoyl]piperidine-1-carboxylate is sourced from PubChem (CID 68985316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).