C25H20N4O3 — CID 68987002
1-methyl-3-[2-[(1-methyl-4-phenylpyrrolo[2,3-b]pyridin-3-yl)methylidene]-3-oxo-1-benzofuran-4-yl]urea (PubChem CID 68987002) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-methyl-3-[2-[(1-methyl-4-phenylpyrrolo[2,3-b]pyridin-3-yl)methylidene]-3-oxo-1-benzofuran-4-yl]urea.
| Compound Name | 1-methyl-3-[2-[(1-methyl-4-phenylpyrrolo[2,3-b]pyridin-3-yl)methylidene]-3-oxo-1-benzofuran-4-yl]urea |
|---|---|
| PubChem CID | 68987002 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-methyl-3-[2-[(1-methyl-4-phenylpyrrolo[2,3-b]pyridin-3-yl)methylidene]-3-oxo-1-benzofuran-4-yl]urea |
| SMILES | CNC(=O)Nc1cccc2c1C(=O)C(=Cc1cn(C)c3nccc(-c4ccccc4)c13)O2 |
| InChI | InChI=1S/C25H20N4O3/c1-26-25(31)28-18-9-6-10-19-22(18)23(30)20(32-19)13-16-14-29(2)24-21(16)17(11-12-27-24)15-7-4-3-5-8-15/h3-14H,1-2H3,(H2,26,28,31) |
| InChIKey | OHMRIQYVXASDES-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|