C48H34N2O8 — CID 67028526
4,6-dihydroxy-2-[(1-methyl-4-phenylindol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 67028526) has the molecular formula C48H34N2O8 and a molecular weight of 766.81 g/mol. Its IUPAC name is 4,6-dihydroxy-2-[(1-methyl-4-phenylindol-3-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | 4,6-dihydroxy-2-[(1-methyl-4-phenylindol-3-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 67028526 |
| Molecular Formula | C48H34N2O8 |
| Molecular Weight | 766.81 g/mol |
| Exact Mass | 766.23 |
| IUPAC Name | 4,6-dihydroxy-2-[(1-methyl-4-phenylindol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | Cn1cc(C=C2Oc3cc(O)cc(O)c3C2=O)c2c(-c3ccccc3)cccc21.Cn1cc(C=C2Oc3cc(O)cc(O)c3C2=O)c2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/2C24H17NO4/c2*1-25-13-15(10-21-24(28)23-19(27)11-16(26)12-20(23)29-21)22-17(8-5-9-18(22)25)14-6-3-2-4-7-14/h2*2-13,26-27H,1H3 |
| InChIKey | RZRMRMNLVAKZFE-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.81 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|