C26H21N3O3 — CID 67028171
1-methyl-3-[2-[(1-methyl-4-phenylindol-3-yl)methylidene]-3-oxo-1-benzofuran-5-yl]urea (PubChem CID 67028171) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-methyl-3-[2-[(1-methyl-4-phenylindol-3-yl)methylidene]-3-oxo-1-benzofuran-5-yl]urea.
| Compound Name | 1-methyl-3-[2-[(1-methyl-4-phenylindol-3-yl)methylidene]-3-oxo-1-benzofuran-5-yl]urea |
|---|---|
| PubChem CID | 67028171 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-methyl-3-[2-[(1-methyl-4-phenylindol-3-yl)methylidene]-3-oxo-1-benzofuran-5-yl]urea |
| SMILES | CNC(=O)Nc1ccc2c(c1)C(=O)C(=Cc1cn(C)c3cccc(-c4ccccc4)c13)O2 |
| InChI | InChI=1S/C26H21N3O3/c1-27-26(31)28-18-11-12-22-20(14-18)25(30)23(32-22)13-17-15-29(2)21-10-6-9-19(24(17)21)16-7-4-3-5-8-16/h3-15H,1-2H3,(H2,27,28,31) |
| InChIKey | SBTOULIRPPVCAK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|