C26H20N2O6 — CID 67028210
[4-[3-[(4,6-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-1-methylindol-4-yl]phenyl]-methylcarbamic acid (PubChem CID 67028210) has the molecular formula C26H20N2O6 and a molecular weight of 456.45 g/mol. Its IUPAC name is [4-[3-[(4,6-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-1-methylindol-4-yl]phenyl]-methylcarbamic acid.
| Compound Name | [4-[3-[(4,6-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-1-methylindol-4-yl]phenyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 67028210 |
| Molecular Formula | C26H20N2O6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [4-[3-[(4,6-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-1-methylindol-4-yl]phenyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1ccc(-c2cccc3c2c(C=C2Oc4cc(O)cc(O)c4C2=O)cn3C)cc1 |
| InChI | InChI=1S/C26H20N2O6/c1-27-13-15(10-22-25(31)24-20(30)11-17(29)12-21(24)34-22)23-18(4-3-5-19(23)27)14-6-8-16(9-7-14)28(2)26(32)33/h3-13,29-30H,1-2H3,(H,32,33) |
| InChIKey | DZRKIWMMBMKRDS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|