C30H29N3O5 — CID 69002046
4-[3-[(Z)-(4,6-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-1-methylindol-4-yl]-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 69002046) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is 4-[3-[(Z)-(4,6-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-1-methylindol-4-yl]-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 4-[3-[(Z)-(4,6-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-1-methylindol-4-yl]-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 69002046 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 4-[3-[(Z)-(4,6-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-1-methylindol-4-yl]-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2cccc3c2c(/C=C2\Oc4cc(O)cc(O)c4C2=O)cn3C)cc1 |
| InChI | InChI=1S/C30H29N3O5/c1-32(2)13-5-12-31-30(37)19-10-8-18(9-11-19)22-6-4-7-23-27(22)20(17-33(23)3)14-26-29(36)28-24(35)15-21(34)16-25(28)38-26/h4,6-11,14-17,34-35H,5,12-13H2,1-3H3,(H,31,37)/b26-14- |
| InChIKey | UYRPFQXXISETIA-WGARJPEWSA-N |
| XLogP | 4.55 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|