C18H17N5O3S — CID 68987052
2-amino-N-[5-(benzenesulfonyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]benzamide (PubChem CID 68987052) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-amino-N-[5-(benzenesulfonyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]benzamide.
| Compound Name | 2-amino-N-[5-(benzenesulfonyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 68987052 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-amino-N-[5-(benzenesulfonyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]benzamide |
| SMILES | Nc1ccccc1C(=O)Nc1n[nH]c2c1CN(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C18H17N5O3S/c19-15-9-5-4-8-13(15)18(24)20-17-14-10-23(11-16(14)21-22-17)27(25,26)12-6-2-1-3-7-12/h1-9H,10-11,19H2,(H2,20,21,22,24) |
| InChIKey | NRDGSJBSNUAZBW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|