C8H8BrF3N2O — CID 68987166
5-(bromomethyl)-2,3-dimethyl-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 68987166) has the molecular formula C8H8BrF3N2O and a molecular weight of 285.06 g/mol. Its IUPAC name is 5-(bromomethyl)-2,3-dimethyl-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 5-(bromomethyl)-2,3-dimethyl-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 68987166 |
| Molecular Formula | C8H8BrF3N2O |
| Molecular Weight | 285.06 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 5-(bromomethyl)-2,3-dimethyl-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | Cc1nc(C(F)(F)F)c(CBr)c(=O)n1C |
| InChI | InChI=1S/C8H8BrF3N2O/c1-4-13-6(8(10,11)12)5(3-9)7(15)14(4)2/h3H2,1-2H3 |
| InChIKey | YPBCMZDLTSNAPH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.06 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|