About methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate
methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate (PubChem CID 68989004) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate |
| PubChem CID | 68989004 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate |
| SMILES | COC(=O)c1ncn([C@H]2CCC[C@@H]2O)c1-c1ccccc1 |
| InChI | InChI=1S/C16H18N2O3/c1-21-16(20)14-15(11-6-3-2-4-7-11)18(10-17-14)12-8-5-9-13(12)19/h2-4,6-7,10,12-13,19H,5,8-9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | FOBADBOBYOVWCD-STQMWFEESA-N |
| XLogP | 2.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate?
The IUPAC name of methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate (CID 68989004) is methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate.
What is the SMILES notation for methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate?
The canonical SMILES for methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate is COC(=O)c1ncn([C@H]2CCC[C@@H]2O)c1-c1ccccc1.
What is the InChIKey of methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate?
The InChIKey is FOBADBOBYOVWCD-STQMWFEESA-N. The full InChI is InChI=1S/C16H18N2O3/c1-21-16(20)14-15(11-6-3-2-4-7-11)18(10-17-14)12-8-5-9-13(12)19/h2-4,6-7,10,12-13,19H,5,8-9H2,1H3/t12-,13-/m0/s1.
What are the key properties of methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate?
methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate has a molecular weight of 286.33 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(1S,2S)-2-hydroxycyclopentyl]-5-phenylimidazole-4-carboxylate is sourced from PubChem (CID 68989004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).