C21H29N3O7 — CID 68990131
(2R)-2-[2-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-6-yl]oxy]ethyl]piperazine-1,4-dicarboxylic acid (PubChem CID 68990131) has the molecular formula C21H29N3O7 and a molecular weight of 435.48 g/mol. Its IUPAC name is (2R)-2-[2-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-6-yl]oxy]ethyl]piperazine-1,4-dicarboxylic acid.
| Compound Name | (2R)-2-[2-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-6-yl]oxy]ethyl]piperazine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 68990131 |
| Molecular Formula | C21H29N3O7 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (2R)-2-[2-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-6-yl]oxy]ethyl]piperazine-1,4-dicarboxylic acid |
| SMILES | COCCCN1C(=O)CCc2cc(OCC[C@@H]3CN(C(=O)O)CCN3C(=O)O)ccc21 |
| InChI | InChI=1S/C21H29N3O7/c1-30-11-2-8-24-18-5-4-17(13-15(18)3-6-19(24)25)31-12-7-16-14-22(20(26)27)9-10-23(16)21(28)29/h4-5,13,16H,2-3,6-12,14H2,1H3,(H,26,27)(H,28,29)/t16-/m1/s1 |
| InChIKey | NJSQLBLQVSTXGY-MRXNPFEDSA-N |
| XLogP | 2.11 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|