About 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one
1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one (PubChem CID 68992138) has the molecular formula C17H22FN3O2
and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one |
| PubChem CID | 68992138 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one |
| SMILES | NC[C@@H]1C[C@H](O)CN(CCn2c(=O)ccc3ccc(F)cc32)C1 |
| InChI | InChI=1S/C17H22FN3O2/c18-14-3-1-13-2-4-17(23)21(16(13)8-14)6-5-20-10-12(9-19)7-15(22)11-20/h1-4,8,12,15,22H,5-7,9-11,19H2/t12-,15-/m0/s1 |
| InChIKey | UQTMMIQOGRTIRF-WFASDCNBSA-N |
| XLogP | 0.78 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one?
The IUPAC name of 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one (CID 68992138) is 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one.
What is the SMILES notation for 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one?
The canonical SMILES for 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one is NC[C@@H]1C[C@H](O)CN(CCn2c(=O)ccc3ccc(F)cc32)C1.
What is the InChIKey of 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one?
The InChIKey is UQTMMIQOGRTIRF-WFASDCNBSA-N. The full InChI is InChI=1S/C17H22FN3O2/c18-14-3-1-13-2-4-17(23)21(16(13)8-14)6-5-20-10-12(9-19)7-15(22)11-20/h1-4,8,12,15,22H,5-7,9-11,19H2/t12-,15-/m0/s1.
What are the key properties of 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one?
1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one has a molecular weight of 319.38 g/mol, XLogP of 0.78, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3S,5S)-3-(aminomethyl)-5-hydroxypiperidin-1-yl]ethyl]-7-fluoroquinolin-2-one is sourced from PubChem (CID 68992138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).