About 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one
2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one (PubChem CID 70748349) has the molecular formula C15H18FN3O2
and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one |
| PubChem CID | 70748349 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one |
| SMILES | N[C@@H]1CCN(Cc2cc(=O)c3cc(F)ccc3[nH]2)C[C@H]1O |
| InChI | InChI=1S/C15H18FN3O2/c16-9-1-2-13-11(5-9)14(20)6-10(18-13)7-19-4-3-12(17)15(21)8-19/h1-2,5-6,12,15,21H,3-4,7-8,17H2,(H,18,20)/t12-,15-/m1/s1 |
| InChIKey | MPCFABUTRZRHBT-IUODEOHRSA-N |
| XLogP | 0.56 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one?
The IUPAC name of 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one (CID 70748349) is 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one.
What is the SMILES notation for 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one?
The canonical SMILES for 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one is N[C@@H]1CCN(Cc2cc(=O)c3cc(F)ccc3[nH]2)C[C@H]1O.
What is the InChIKey of 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one?
The InChIKey is MPCFABUTRZRHBT-IUODEOHRSA-N. The full InChI is InChI=1S/C15H18FN3O2/c16-9-1-2-13-11(5-9)14(20)6-10(18-13)7-19-4-3-12(17)15(21)8-19/h1-2,5-6,12,15,21H,3-4,7-8,17H2,(H,18,20)/t12-,15-/m1/s1.
What are the key properties of 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one?
2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one has a molecular weight of 291.33 g/mol, XLogP of 0.56, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-6-fluoro-1H-quinolin-4-one is sourced from PubChem (CID 70748349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).