C40H42N8 — CID 68993447
1-[3-(N-amino-4-methylanilino)-5-[3,5-bis(N-amino-4-methylanilino)phenyl]phenyl]-1-(4-methylphenyl)hydrazine (PubChem CID 68993447) has the molecular formula C40H42N8 and a molecular weight of 634.83 g/mol. Its IUPAC name is 1-[3-(N-amino-4-methylanilino)-5-[3,5-bis(N-amino-4-methylanilino)phenyl]phenyl]-1-(4-methylphenyl)hydrazine.
| Compound Name | 1-[3-(N-amino-4-methylanilino)-5-[3,5-bis(N-amino-4-methylanilino)phenyl]phenyl]-1-(4-methylphenyl)hydrazine |
|---|---|
| PubChem CID | 68993447 |
| Molecular Formula | C40H42N8 |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | 1-[3-(N-amino-4-methylanilino)-5-[3,5-bis(N-amino-4-methylanilino)phenyl]phenyl]-1-(4-methylphenyl)hydrazine |
| SMILES | Cc1ccc(N(N)c2cc(-c3cc(N(N)c4ccc(C)cc4)cc(N(N)c4ccc(C)cc4)c3)cc(N(N)c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C40H42N8/c1-27-5-13-33(14-6-27)45(41)37-21-31(22-38(25-37)46(42)34-15-7-28(2)8-16-34)32-23-39(47(43)35-17-9-29(3)10-18-35)26-40(24-32)48(44)36-19-11-30(4)12-20-36/h5-26H,41-44H2,1-4H3 |
| InChIKey | PEOXBURYDOGHPD-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|