C30H37N5O3 — CID 68993594
tert-butyl N-[4-(dibenzylamino)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-N-(ethoxymethyl)carbamate (PubChem CID 68993594) has the molecular formula C30H37N5O3 and a molecular weight of 515.66 g/mol. Its IUPAC name is tert-butyl N-[4-(dibenzylamino)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-N-(ethoxymethyl)carbamate.
| Compound Name | tert-butyl N-[4-(dibenzylamino)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-N-(ethoxymethyl)carbamate |
|---|---|
| PubChem CID | 68993594 |
| Molecular Formula | C30H37N5O3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | tert-butyl N-[4-(dibenzylamino)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-N-(ethoxymethyl)carbamate |
| SMILES | CCOCN(C(=O)OC(C)(C)C)n1cnc2c(N(Cc3ccccc3)Cc3ccccc3)nc(C)c(C)c21 |
| InChI | InChI=1S/C30H37N5O3/c1-7-37-21-35(29(36)38-30(4,5)6)34-20-31-26-27(34)22(2)23(3)32-28(26)33(18-24-14-10-8-11-15-24)19-25-16-12-9-13-17-25/h8-17,20H,7,18-19,21H2,1-6H3 |
| InChIKey | UPUBFRLAYIVFMY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|