C24H33Cl2N7O — CID 68997109
N-[(2,4-dichlorophenyl)methyl]-2-[4-[(4-methylmorpholin-3-yl)methyl]piperazin-1-yl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine (PubChem CID 68997109) has the molecular formula C24H33Cl2N7O and a molecular weight of 506.48 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-[4-[(4-methylmorpholin-3-yl)methyl]piperazin-1-yl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-[4-[(4-methylmorpholin-3-yl)methyl]piperazin-1-yl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 68997109 |
| Molecular Formula | C24H33Cl2N7O |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-[4-[(4-methylmorpholin-3-yl)methyl]piperazin-1-yl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CN1CCOCC1CN1CCN(c2nc3c(c(NCc4ccc(Cl)cc4Cl)n2)CNCC3)CC1 |
| InChI | InChI=1S/C24H33Cl2N7O/c1-31-10-11-34-16-19(31)15-32-6-8-33(9-7-32)24-29-22-4-5-27-14-20(22)23(30-24)28-13-17-2-3-18(25)12-21(17)26/h2-3,12,19,27H,4-11,13-16H2,1H3,(H,28,29,30) |
| InChIKey | JVFSPOGEKIRBAE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |