C22H18N4O2S — CID 68999027
5-acetamido-N-[2-[(E)-2-(1H-indazol-3-yl)ethenyl]phenyl]thiophene-2-carboxamide (PubChem CID 68999027) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is 5-acetamido-N-[2-[(E)-2-(1H-indazol-3-yl)ethenyl]phenyl]thiophene-2-carboxamide.
| Compound Name | 5-acetamido-N-[2-[(E)-2-(1H-indazol-3-yl)ethenyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 68999027 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 5-acetamido-N-[2-[(E)-2-(1H-indazol-3-yl)ethenyl]phenyl]thiophene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccccc2/C=C/c2n[nH]c3ccccc23)s1 |
| InChI | InChI=1S/C22H18N4O2S/c1-14(27)23-21-13-12-20(29-21)22(28)24-17-8-4-2-6-15(17)10-11-19-16-7-3-5-9-18(16)25-26-19/h2-13H,1H3,(H,23,27)(H,24,28)(H,25,26)/b11-10+ |
| InChIKey | DTIMODBWWXXRQL-ZHACJKMWSA-N |
| XLogP | 5.01 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |