C20H25IN2O — CID 68999578
1-benzyl-N-[2-(2-iodo-5-methoxyphenyl)ethyl]pyrrolidin-3-amine (PubChem CID 68999578) has the molecular formula C20H25IN2O and a molecular weight of 436.34 g/mol. Its IUPAC name is 1-benzyl-N-[2-(2-iodo-5-methoxyphenyl)ethyl]pyrrolidin-3-amine.
| Compound Name | 1-benzyl-N-[2-(2-iodo-5-methoxyphenyl)ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 68999578 |
| Molecular Formula | C20H25IN2O |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-benzyl-N-[2-(2-iodo-5-methoxyphenyl)ethyl]pyrrolidin-3-amine |
| SMILES | COc1ccc(I)c(CCNC2CCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C20H25IN2O/c1-24-19-7-8-20(21)17(13-19)9-11-22-18-10-12-23(15-18)14-16-5-3-2-4-6-16/h2-8,13,18,22H,9-12,14-15H2,1H3 |
| InChIKey | MPCPOYNDCNVKLC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|