C18H28N4O4S — CID 69000638
(2S)-2-amino-4-methyl-N-(5-methyl-3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)pentanamide (PubChem CID 69000638) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-(5-methyl-3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-(5-methyl-3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)pentanamide |
|---|---|
| PubChem CID | 69000638 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-(5-methyl-3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NC1C(=O)CN(S(=O)(=O)c2ccccn2)CCC1C |
| InChI | InChI=1S/C18H28N4O4S/c1-12(2)10-14(19)18(24)21-17-13(3)7-9-22(11-15(17)23)27(25,26)16-6-4-5-8-20-16/h4-6,8,12-14,17H,7,9-11,19H2,1-3H3,(H,21,24)/t13?,14-,17?/m0/s1 |
| InChIKey | PNMBYKZJLBBZMD-UUCFBXCCSA-N |
| XLogP | 0.54 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |