C12H15ClN4 — CID 69000769
3-N-(4-chlorobutyl)-1,5-naphthyridine-3,4-diamine (PubChem CID 69000769) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-N-(4-chlorobutyl)-1,5-naphthyridine-3,4-diamine.
| Compound Name | 3-N-(4-chlorobutyl)-1,5-naphthyridine-3,4-diamine |
|---|---|
| PubChem CID | 69000769 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-N-(4-chlorobutyl)-1,5-naphthyridine-3,4-diamine |
| SMILES | Nc1c(NCCCCCl)cnc2cccnc12 |
| InChI | InChI=1S/C12H15ClN4/c13-5-1-2-6-15-10-8-17-9-4-3-7-16-12(9)11(10)14/h3-4,7-8,15H,1-2,5-6H2,(H2,14,17) |
| InChIKey | JVOKYSIBSSDVFS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|