About 1,5-naphthyridine-3,4-diamine
1,5-naphthyridine-3,4-diamine (PubChem CID 22172703) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 1,5-naphthyridine-3,4-diamine.
Molecular Properties
| Compound Name | 1,5-naphthyridine-3,4-diamine |
| PubChem CID | 22172703 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1,5-naphthyridine-3,4-diamine |
| SMILES | Nc1cnc2cccnc2c1N |
| InChI | InChI=1S/C8H8N4/c9-5-4-12-6-2-1-3-11-8(6)7(5)10/h1-4H,9H2,(H2,10,12) |
| InChIKey | MIDQVYLLSDOPIL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-naphthyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-naphthyridine-3,4-diamine?
The IUPAC name of 1,5-naphthyridine-3,4-diamine (CID 22172703) is 1,5-naphthyridine-3,4-diamine.
What is the SMILES notation for 1,5-naphthyridine-3,4-diamine?
The canonical SMILES for 1,5-naphthyridine-3,4-diamine is Nc1cnc2cccnc2c1N.
What is the InChIKey of 1,5-naphthyridine-3,4-diamine?
The InChIKey is MIDQVYLLSDOPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c9-5-4-12-6-2-1-3-11-8(6)7(5)10/h1-4H,9H2,(H2,10,12).
What are the key properties of 1,5-naphthyridine-3,4-diamine?
1,5-naphthyridine-3,4-diamine has a molecular weight of 160.18 g/mol, XLogP of 0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-naphthyridine-3,4-diamine is sourced from PubChem (CID 22172703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).