C9H8N4 — CID 144514772
acetylene;pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 144514772) has the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. Its IUPAC name is acetylene;pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | acetylene;pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 144514772 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | acetylene;pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | C#C.Nc1ncnc2cccnc12 |
| InChI | InChI=1S/C7H6N4.C2H2/c8-7-6-5(10-4-11-7)2-1-3-9-6;1-2/h1-4H,(H2,8,10,11);1-2H |
| InChIKey | ZWOGPKPHXKBHJL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|