About 7-amino-1,6-naphthyridin-8-ol
7-amino-1,6-naphthyridin-8-ol (PubChem CID 22765613) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 7-amino-1,6-naphthyridin-8-ol.
Molecular Properties
| Compound Name | 7-amino-1,6-naphthyridin-8-ol |
| PubChem CID | 22765613 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 7-amino-1,6-naphthyridin-8-ol |
| SMILES | Nc1ncc2cccnc2c1O |
| InChI | InChI=1S/C8H7N3O/c9-8-7(12)6-5(4-11-8)2-1-3-10-6/h1-4,12H,(H2,9,11) |
| InChIKey | HUGLYJKQQGMPEC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-amino-1,6-naphthyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-1,6-naphthyridin-8-ol?
The IUPAC name of 7-amino-1,6-naphthyridin-8-ol (CID 22765613) is 7-amino-1,6-naphthyridin-8-ol.
What is the SMILES notation for 7-amino-1,6-naphthyridin-8-ol?
The canonical SMILES for 7-amino-1,6-naphthyridin-8-ol is Nc1ncc2cccnc2c1O.
What is the InChIKey of 7-amino-1,6-naphthyridin-8-ol?
The InChIKey is HUGLYJKQQGMPEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-8-7(12)6-5(4-11-8)2-1-3-10-6/h1-4,12H,(H2,9,11).
What are the key properties of 7-amino-1,6-naphthyridin-8-ol?
7-amino-1,6-naphthyridin-8-ol has a molecular weight of 161.16 g/mol, XLogP of 0.92, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-1,6-naphthyridin-8-ol is sourced from PubChem (CID 22765613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).