C10H8N2O3 — CID 58939943
(8-hydroxy-1,6-naphthyridin-7-yl) acetate (PubChem CID 58939943) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is (8-hydroxy-1,6-naphthyridin-7-yl) acetate.
| Compound Name | (8-hydroxy-1,6-naphthyridin-7-yl) acetate |
|---|---|
| PubChem CID | 58939943 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (8-hydroxy-1,6-naphthyridin-7-yl) acetate |
| SMILES | CC(=O)Oc1ncc2cccnc2c1O |
| InChI | InChI=1S/C10H8N2O3/c1-6(13)15-10-9(14)8-7(5-12-10)3-2-4-11-8/h2-5,14H,1H3 |
| InChIKey | HBUXEVVCEIJMNF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |