C7H8N4 — CID 67783033
2-methylpyrazolo[4,3-b]pyridin-3-amine (PubChem CID 67783033) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is 2-methylpyrazolo[4,3-b]pyridin-3-amine.
| Compound Name | 2-methylpyrazolo[4,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 67783033 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2-methylpyrazolo[4,3-b]pyridin-3-amine |
| SMILES | Cn1nc2cccnc2c1N |
| InChI | InChI=1S/C7H8N4/c1-11-7(8)6-5(10-11)3-2-4-9-6/h2-4H,8H2,1H3 |
| InChIKey | MPKNUJFUIIZLAA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |