C24H23N3O6 — CID 69002656
(2Z)-4,6-dihydroxy-2-[[5-methoxy-2-(4-methylpiperazine-1-carbonyl)-1H-indol-3-yl]methylidene]-1-benzofuran-3-one (PubChem CID 69002656) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is (2Z)-4,6-dihydroxy-2-[[5-methoxy-2-(4-methylpiperazine-1-carbonyl)-1H-indol-3-yl]methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-4,6-dihydroxy-2-[[5-methoxy-2-(4-methylpiperazine-1-carbonyl)-1H-indol-3-yl]methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 69002656 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (2Z)-4,6-dihydroxy-2-[[5-methoxy-2-(4-methylpiperazine-1-carbonyl)-1H-indol-3-yl]methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc2[nH]c(C(=O)N3CCN(C)CC3)c(/C=C3\Oc4cc(O)cc(O)c4C3=O)c2c1 |
| InChI | InChI=1S/C24H23N3O6/c1-26-5-7-27(8-6-26)24(31)22-16(15-11-14(32-2)3-4-17(15)25-22)12-20-23(30)21-18(29)9-13(28)10-19(21)33-20/h3-4,9-12,25,28-29H,5-8H2,1-2H3/b20-12- |
| InChIKey | QGAVZXASWJAOHI-NDENLUEZSA-N |
| XLogP | 2.59 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|