C18H12ClNO4 — CID 69001293
(2E)-2-[(5-chloro-2-methyl-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one (PubChem CID 69001293) has the molecular formula C18H12ClNO4 and a molecular weight of 341.75 g/mol. Its IUPAC name is (2E)-2-[(5-chloro-2-methyl-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one.
| Compound Name | (2E)-2-[(5-chloro-2-methyl-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 69001293 |
| Molecular Formula | C18H12ClNO4 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (2E)-2-[(5-chloro-2-methyl-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1/C=C1/Oc2cc(O)cc(O)c2C1=O |
| InChI | InChI=1S/C18H12ClNO4/c1-8-11(12-4-9(19)2-3-13(12)20-8)7-16-18(23)17-14(22)5-10(21)6-15(17)24-16/h2-7,20-22H,1H3/b16-7+ |
| InChIKey | JFRCWTCNVJQOOV-FRKPEAEDSA-N |
| XLogP | 4.16 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|