C18H12BrNO4 — CID 67028077
2-[(7-bromo-2-methyl-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one (PubChem CID 67028077) has the molecular formula C18H12BrNO4 and a molecular weight of 386.20 g/mol. Its IUPAC name is 2-[(7-bromo-2-methyl-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one.
| Compound Name | 2-[(7-bromo-2-methyl-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 67028077 |
| Molecular Formula | C18H12BrNO4 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 2-[(7-bromo-2-methyl-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
| SMILES | Cc1[nH]c2c(Br)cccc2c1C=C1Oc2cc(O)cc(O)c2C1=O |
| InChI | InChI=1S/C18H12BrNO4/c1-8-11(10-3-2-4-12(19)17(10)20-8)7-15-18(23)16-13(22)5-9(21)6-14(16)24-15/h2-7,20-22H,1H3 |
| InChIKey | ZPEZSFWKQHEWEL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|