C23H14FNO4 — CID 44554910
(2Z)-2-[[2-(4-fluorophenyl)-1H-indol-3-yl]methylidene]-4,6-dihydroxy-1-benzofuran-3-one (PubChem CID 44554910) has the molecular formula C23H14FNO4 and a molecular weight of 387.37 g/mol. Its IUPAC name is (2Z)-2-[[2-(4-fluorophenyl)-1H-indol-3-yl]methylidene]-4,6-dihydroxy-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[[2-(4-fluorophenyl)-1H-indol-3-yl]methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 44554910 |
| Molecular Formula | C23H14FNO4 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (2Z)-2-[[2-(4-fluorophenyl)-1H-indol-3-yl]methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2c(-c3ccc(F)cc3)[nH]c3ccccc23)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C23H14FNO4/c24-13-7-5-12(6-8-13)22-16(15-3-1-2-4-17(15)25-22)11-20-23(28)21-18(27)9-14(26)10-19(21)29-20/h1-11,25-27H/b20-11- |
| InChIKey | RBDLBRJWMFPRHT-JAIQZWGSSA-N |
| XLogP | 5.00 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|