C25H22ClIO3 — CID 69003872
2-[4-[3-(4-chlorophenyl)-3-(4-iodophenyl)prop-2-enoxy]-2-methylphenyl]propanoic acid (PubChem CID 69003872) has the molecular formula C25H22ClIO3 and a molecular weight of 532.81 g/mol. Its IUPAC name is 2-[4-[3-(4-chlorophenyl)-3-(4-iodophenyl)prop-2-enoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 2-[4-[3-(4-chlorophenyl)-3-(4-iodophenyl)prop-2-enoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 69003872 |
| Molecular Formula | C25H22ClIO3 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 2-[4-[3-(4-chlorophenyl)-3-(4-iodophenyl)prop-2-enoxy]-2-methylphenyl]propanoic acid |
| SMILES | Cc1cc(OCC=C(c2ccc(Cl)cc2)c2ccc(I)cc2)ccc1C(C)C(=O)O |
| InChI | InChI=1S/C25H22ClIO3/c1-16-15-22(11-12-23(16)17(2)25(28)29)30-14-13-24(18-3-7-20(26)8-4-18)19-5-9-21(27)10-6-19/h3-13,15,17H,14H2,1-2H3,(H,28,29) |
| InChIKey | BCMDNHDCZLPGER-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|