C22H22ClF3N2O2 — CID 69004829
4-[1-(3-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 69004829) has the molecular formula C22H22ClF3N2O2 and a molecular weight of 438.88 g/mol. Its IUPAC name is 4-[1-(3-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-[1-(3-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 69004829 |
| Molecular Formula | C22H22ClF3N2O2 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 4-[1-(3-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1ccc(C(C(=O)NC2CCCCC2)c2cccc(Cl)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22ClF3N2O2/c23-15-6-4-5-13(11-15)19(21(30)28-16-7-2-1-3-8-16)17-10-9-14(20(27)29)12-18(17)22(24,25)26/h4-6,9-12,16,19H,1-3,7-8H2,(H2,27,29)(H,28,30) |
| InChIKey | YWDAPTOJQPQGPD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |