C8H12N2O — CID 69005073
(4Z)-4-(methoxymethylidene)cyclohexa-1,5-diene-1,3-diamine (PubChem CID 69005073) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is (4Z)-4-(methoxymethylidene)cyclohexa-1,5-diene-1,3-diamine.
| Compound Name | (4Z)-4-(methoxymethylidene)cyclohexa-1,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 69005073 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (4Z)-4-(methoxymethylidene)cyclohexa-1,5-diene-1,3-diamine |
| SMILES | CO/C=C1/C=CC(N)=CC1N |
| InChI | InChI=1S/C8H12N2O/c1-11-5-6-2-3-7(9)4-8(6)10/h2-5,8H,9-10H2,1H3/b6-5- |
| InChIKey | MCVNXVZGJQHRJZ-WAYWQWQTSA-N |
| XLogP | 0.26 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|