C31H33N3O3 — CID 69006396
methyl 1-[2-oxo-2-[4-(4-propan-2-ylphenyl)piperazin-1-yl]ethyl]-3-phenylindole-6-carboxylate (PubChem CID 69006396) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is methyl 1-[2-oxo-2-[4-(4-propan-2-ylphenyl)piperazin-1-yl]ethyl]-3-phenylindole-6-carboxylate.
| Compound Name | methyl 1-[2-oxo-2-[4-(4-propan-2-ylphenyl)piperazin-1-yl]ethyl]-3-phenylindole-6-carboxylate |
|---|---|
| PubChem CID | 69006396 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | methyl 1-[2-oxo-2-[4-(4-propan-2-ylphenyl)piperazin-1-yl]ethyl]-3-phenylindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(-c3ccccc3)cn(CC(=O)N3CCN(c4ccc(C(C)C)cc4)CC3)c2c1 |
| InChI | InChI=1S/C31H33N3O3/c1-22(2)23-9-12-26(13-10-23)32-15-17-33(18-16-32)30(35)21-34-20-28(24-7-5-4-6-8-24)27-14-11-25(19-29(27)34)31(36)37-3/h4-14,19-20,22H,15-18,21H2,1-3H3 |
| InChIKey | DUXBDEDQNWKDQH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|