C29H31N3O3 — CID 70943793
methyl 1-[2-[[2-oxo-2-(4-propan-2-ylanilino)ethyl]amino]ethyl]-3-phenylindole-6-carboxylate (PubChem CID 70943793) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is methyl 1-[2-[[2-oxo-2-(4-propan-2-ylanilino)ethyl]amino]ethyl]-3-phenylindole-6-carboxylate.
| Compound Name | methyl 1-[2-[[2-oxo-2-(4-propan-2-ylanilino)ethyl]amino]ethyl]-3-phenylindole-6-carboxylate |
|---|---|
| PubChem CID | 70943793 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | methyl 1-[2-[[2-oxo-2-(4-propan-2-ylanilino)ethyl]amino]ethyl]-3-phenylindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(-c3ccccc3)cn(CCNCC(=O)Nc3ccc(C(C)C)cc3)c2c1 |
| InChI | InChI=1S/C29H31N3O3/c1-20(2)21-9-12-24(13-10-21)31-28(33)18-30-15-16-32-19-26(22-7-5-4-6-8-22)25-14-11-23(17-27(25)32)29(34)35-3/h4-14,17,19-20,30H,15-16,18H2,1-3H3,(H,31,33) |
| InChIKey | MXARGVALCJQPEQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|