C30H37N3O3 — CID 89193467
methyl 1-[(2Z,4E)-hepta-2,4-dien-4-yl]-3-[2-[[2-oxo-2-(4-propan-2-ylanilino)ethyl]amino]ethyl]indole-5-carboxylate (PubChem CID 89193467) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is methyl 1-[(2Z,4E)-hepta-2,4-dien-4-yl]-3-[2-[[2-oxo-2-(4-propan-2-ylanilino)ethyl]amino]ethyl]indole-5-carboxylate.
| Compound Name | methyl 1-[(2Z,4E)-hepta-2,4-dien-4-yl]-3-[2-[[2-oxo-2-(4-propan-2-ylanilino)ethyl]amino]ethyl]indole-5-carboxylate |
|---|---|
| PubChem CID | 89193467 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | methyl 1-[(2Z,4E)-hepta-2,4-dien-4-yl]-3-[2-[[2-oxo-2-(4-propan-2-ylanilino)ethyl]amino]ethyl]indole-5-carboxylate |
| SMILES | C/C=C\C(=C/CC)n1cc(CCNCC(=O)Nc2ccc(C(C)C)cc2)c2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C30H37N3O3/c1-6-8-26(9-7-2)33-20-24(27-18-23(30(35)36-5)12-15-28(27)33)16-17-31-19-29(34)32-25-13-10-22(11-14-25)21(3)4/h6,8-15,18,20-21,31H,7,16-17,19H2,1-5H3,(H,32,34)/b8-6-,26-9+ |
| InChIKey | WWSCUGQXAREMQR-PCBRCXFASA-N |
| XLogP | 6.15 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|