C22H22F3N3O — CID 69006706
2-(3-cyanophenyl)-N-cyclohexyl-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 69006706) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is 2-(3-cyanophenyl)-N-cyclohexyl-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | 2-(3-cyanophenyl)-N-cyclohexyl-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 69006706 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-(3-cyanophenyl)-N-cyclohexyl-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | N#Cc1cccc(C(Nc2cccc(C(F)(F)F)c2)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C22H22F3N3O/c23-22(24,25)17-8-5-11-19(13-17)27-20(16-7-4-6-15(12-16)14-26)21(29)28-18-9-2-1-3-10-18/h4-8,11-13,18,20,27H,1-3,9-10H2,(H,28,29) |
| InChIKey | NGPKMWRDVXZEJO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |