C30H39F3N6 — CID 69006773
N-(4-tert-butylphenyl)-2-(piperidin-1-ylmethyl)-7-[3-(trifluoromethyl)-2-pyridinyl]-1,2,5,6,8,9-hexahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 69006773) has the molecular formula C30H39F3N6 and a molecular weight of 540.68 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-(piperidin-1-ylmethyl)-7-[3-(trifluoromethyl)-2-pyridinyl]-1,2,5,6,8,9-hexahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | N-(4-tert-butylphenyl)-2-(piperidin-1-ylmethyl)-7-[3-(trifluoromethyl)-2-pyridinyl]-1,2,5,6,8,9-hexahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 69006773 |
| Molecular Formula | C30H39F3N6 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-(piperidin-1-ylmethyl)-7-[3-(trifluoromethyl)-2-pyridinyl]-1,2,5,6,8,9-hexahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | CC(C)(C)c1ccc(NC2=NC(CN3CCCCC3)NC3=C2CCN(c2ncccc2C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C30H39F3N6/c1-29(2,3)21-9-11-22(12-10-21)35-27-23-13-18-39(28-24(30(31,32)33)8-7-15-34-28)19-14-25(23)36-26(37-27)20-38-16-5-4-6-17-38/h7-12,15,26,36H,4-6,13-14,16-20H2,1-3H3,(H,35,37) |
| InChIKey | RULPAZAQCSNBJM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |