C24H26F6N6O — CID 151462370
2-(2-methoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 151462370) has the molecular formula C24H26F6N6O and a molecular weight of 528.50 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 2-(2-methoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 151462370 |
| Molecular Formula | C24H26F6N6O |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 2-(2-methoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | COCCC1(N)N=C(Nc2ccc(C(F)(F)F)cc2)C2=C(CCN(c3ncccc3C(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C24H26F6N6O/c1-37-14-10-22(31)34-19-9-13-36(21-18(24(28,29)30)3-2-11-32-21)12-8-17(19)20(35-22)33-16-6-4-15(5-7-16)23(25,26)27/h2-7,11,34H,8-10,12-14,31H2,1H3,(H,33,35) |
| InChIKey | PISRIIZQRCCCDZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |