C25H31F3N6 — CID 152770746
4-(4-tert-butylphenyl)-2-methylimino-7-[3-(trifluoromethyl)-2-pyridinyl]-1,3,5,6,8,9-hexahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 152770746) has the molecular formula C25H31F3N6 and a molecular weight of 472.56 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2-methylimino-7-[3-(trifluoromethyl)-2-pyridinyl]-1,3,5,6,8,9-hexahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | 4-(4-tert-butylphenyl)-2-methylimino-7-[3-(trifluoromethyl)-2-pyridinyl]-1,3,5,6,8,9-hexahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 152770746 |
| Molecular Formula | C25H31F3N6 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2-methylimino-7-[3-(trifluoromethyl)-2-pyridinyl]-1,3,5,6,8,9-hexahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | C/N=C1\NC2=C(CCN(c3ncccc3C(F)(F)F)CC2)C(N)(c2ccc(C(C)(C)C)cc2)N1 |
| InChI | InChI=1S/C25H31F3N6/c1-23(2,3)16-7-9-17(10-8-16)24(29)18-11-14-34(15-12-20(18)32-22(30-4)33-24)21-19(25(26,27)28)6-5-13-31-21/h5-10,13H,11-12,14-15,29H2,1-4H3,(H2,30,32,33) |
| InChIKey | DFIMZKDKPRPLBD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|