C13H12N2 — CID 69007516
4-(2,5-dihydropyridin-4-yl)-3-methylbenzonitrile (PubChem CID 69007516) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-(2,5-dihydropyridin-4-yl)-3-methylbenzonitrile.
| Compound Name | 4-(2,5-dihydropyridin-4-yl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 69007516 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-(2,5-dihydropyridin-4-yl)-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1C1=CCN=CC1 |
| InChI | InChI=1S/C13H12N2/c1-10-8-11(9-14)2-3-13(10)12-4-6-15-7-5-12/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | BKQJOANJFANHOW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |