C24H30ClFN2O3S — CID 69007640
(2S)-1-[2-[2-(3-fluorophenyl)sulfanyl-4-piperidin-1-ylphenoxy]ethyl]pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 69007640) has the molecular formula C24H30ClFN2O3S and a molecular weight of 481.03 g/mol. Its IUPAC name is (2S)-1-[2-[2-(3-fluorophenyl)sulfanyl-4-piperidin-1-ylphenoxy]ethyl]pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2S)-1-[2-[2-(3-fluorophenyl)sulfanyl-4-piperidin-1-ylphenoxy]ethyl]pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 69007640 |
| Molecular Formula | C24H30ClFN2O3S |
| Molecular Weight | 481.03 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (2S)-1-[2-[2-(3-fluorophenyl)sulfanyl-4-piperidin-1-ylphenoxy]ethyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1CCCN1CCOc1ccc(N2CCCCC2)cc1Sc1cccc(F)c1 |
| InChI | InChI=1S/C24H29FN2O3S.ClH/c25-18-6-4-7-20(16-18)31-23-17-19(26-11-2-1-3-12-26)9-10-22(23)30-15-14-27-13-5-8-21(27)24(28)29;/h4,6-7,9-10,16-17,21H,1-3,5,8,11-15H2,(H,28,29);1H/t21-;/m0./s1 |
| InChIKey | ALOQMSIRIIMGMB-BOXHHOBZSA-N |
| XLogP | 5.32 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.03 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|