C45H46O10 — CID 69007718
1,3-bis(4-benzoyl-3-hydroxyphenoxy)propan-2-yl prop-2-enoate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) prop-2-enoate (PubChem CID 69007718) has the molecular formula C45H46O10 and a molecular weight of 746.85 g/mol. Its IUPAC name is 1,3-bis(4-benzoyl-3-hydroxyphenoxy)propan-2-yl prop-2-enoate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) prop-2-enoate.
| Compound Name | 1,3-bis(4-benzoyl-3-hydroxyphenoxy)propan-2-yl prop-2-enoate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) prop-2-enoate |
|---|---|
| PubChem CID | 69007718 |
| Molecular Formula | C45H46O10 |
| Molecular Weight | 746.85 g/mol |
| Exact Mass | 746.31 |
| IUPAC Name | 1,3-bis(4-benzoyl-3-hydroxyphenoxy)propan-2-yl prop-2-enoate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) prop-2-enoate |
| SMILES | C=CC(=O)OC(COc1ccc(C(=O)c2ccccc2)c(O)c1)COc1ccc(C(=O)c2ccccc2)c(O)c1.C=CC(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C32H26O8.C13H20O2/c1-2-30(35)40-25(19-38-23-13-15-26(28(33)17-23)31(36)21-9-5-3-6-10-21)20-39-24-14-16-27(29(34)18-24)32(37)22-11-7-4-8-12-22;1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3/h2-18,25,33-34H,1,19-20H2;5,9-10H,1,6-8H2,2-4H3 |
| InChIKey | KNPNMLWNHDVHKV-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.85 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|