C25H37NO4 — CID 69008627
[(3S,5S,8S,9S,10R,13S,14S)-10,13-dimethyl-6,7-dioxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (3R)-piperidine-3-carboxylate (PubChem CID 69008627) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is [(3S,5S,8S,9S,10R,13S,14S)-10,13-dimethyl-6,7-dioxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (3R)-piperidine-3-carboxylate.
| Compound Name | [(3S,5S,8S,9S,10R,13S,14S)-10,13-dimethyl-6,7-dioxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (3R)-piperidine-3-carboxylate |
|---|---|
| PubChem CID | 69008627 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | [(3S,5S,8S,9S,10R,13S,14S)-10,13-dimethyl-6,7-dioxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (3R)-piperidine-3-carboxylate |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C(=O)C(=O)[C@H]3C[C@@H](OC(=O)[C@@H]4CCCNC4)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C25H37NO4/c1-24-9-3-6-17(24)20-18(8-10-24)25(2)11-7-16(13-19(25)21(27)22(20)28)30-23(29)15-5-4-12-26-14-15/h15-20,26H,3-14H2,1-2H3/t15-,16+,17+,18+,19-,20+,24+,25-/m1/s1 |
| InChIKey | ANKYLVXTODTGIV-ZHHREOSHSA-N |
| XLogP | 3.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|