C18H15Br2Cl2NO3 — CID 69011580
(E)-3-[3,5-dibromo-4-[[2,5-dichloro-3-(ethylamino)phenyl]methoxy]phenyl]prop-2-enoic acid (PubChem CID 69011580) has the molecular formula C18H15Br2Cl2NO3 and a molecular weight of 524.04 g/mol. Its IUPAC name is (E)-3-[3,5-dibromo-4-[[2,5-dichloro-3-(ethylamino)phenyl]methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dibromo-4-[[2,5-dichloro-3-(ethylamino)phenyl]methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69011580 |
| Molecular Formula | C18H15Br2Cl2NO3 |
| Molecular Weight | 524.04 g/mol |
| Exact Mass | 520.88 |
| IUPAC Name | (E)-3-[3,5-dibromo-4-[[2,5-dichloro-3-(ethylamino)phenyl]methoxy]phenyl]prop-2-enoic acid |
| SMILES | CCNc1cc(Cl)cc(COc2c(Br)cc(/C=C/C(=O)O)cc2Br)c1Cl |
| InChI | InChI=1S/C18H15Br2Cl2NO3/c1-2-23-15-8-12(21)7-11(17(15)22)9-26-18-13(19)5-10(6-14(18)20)3-4-16(24)25/h3-8,23H,2,9H2,1H3,(H,24,25)/b4-3+ |
| InChIKey | ZLDLDELGJKMXJE-ONEGZZNKSA-N |
| XLogP | 6.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.04 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|